4-Fluoro-2,5-dimethylbenzoic acid(CAT: L000210) is an important compound in organic chemistry, particularly in the synthesis of various organic molecules. This compound serves as a valuable building block for creating a wide range of organic intermediates, including pharmaceutical agents and agrochemicals. Its unique chemical structure, featuring a fluorine atom, allows for precise structural modifications, making it an essential component for researchers working to design and synthesize complex molecules.
| Catalog Number | L000210 |
| CAS Number | 1427082-14-1 |
| Molecular Formula | C9H9FO2 |
| Purity | 95% |
| IUPAC Name | 4-fluoro-2,5-dimethylbenzoic acid |
| InChI | InChI=1S/C9H9FO2/c1-5-4-8(10)6(2)3-7(5)9(11)12/h3-4H,1-2H3,(H,11,12) |
| InChIKey | YQUAYBHLIPCMOM-UHFFFAOYSA-N |
