For research use only. Not for therapeutic Use.
4-Fluoro-2-methylbenzo[d]oxazole(Cat No.:L021435)is a fluorinated heterocyclic compound featuring a fluorine atom and a methyl group on a benzo[d]oxazole ring. This compound is important in pharmaceutical research and organic synthesis as a building block for developing bioactive molecules, including potential drug candidates and agrochemicals. The fluorine atom enhances the compound’s metabolic stability and bioavailability, making it valuable in drug design. Its structure allows for diverse chemical modifications, supporting the creation of complex molecular frameworks. High purity and consistent quality ensure its effectiveness in advanced research applications.
CAS Number | 1804412-63-2 |
Molecular Formula | C8H6FNO |
Purity | ≥95% |
IUPAC Name | 4-fluoro-2-methyl-1,3-benzoxazole |
InChI | InChI=1S/C8H6FNO/c1-5-10-8-6(9)3-2-4-7(8)11-5/h2-4H,1H3 |
InChIKey | XGJVKAJFMHDNEM-UHFFFAOYSA-N |
SMILES | CC1=NC2=C(O1)C=CC=C2F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |