For research use only. Not for therapeutic Use.
4-Ethoxy-3-ethylphenylboronic acid (Cat.No:L003807) is a pivotal compound in organic synthesis. Its distinctive structure, incorporating both boronic acid and ethoxyethyl moieties, confers unique reactivity and applications. This compound is a valuable building block for the creation of specialized organic molecules with applications in pharmaceutical and chemical research.
CAS Number | 2121512-95-4 |
Molecular Formula | C10H15BO3 |
Purity | ≥95% |
IUPAC Name | (4-ethoxy-3-ethylphenyl)boronic acid |
InChI | InChI=1S/C10H15BO3/c1-3-8-7-9(11(12)13)5-6-10(8)14-4-2/h5-7,12-13H,3-4H2,1-2H3 |
InChIKey | RCWDMKYCDBVVEY-UHFFFAOYSA-N |
SMILES | B(C1=CC(=C(C=C1)OCC)CC)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |