For research use only. Not for therapeutic Use.
4-Ethoxy-2-fluoroaniline(Cat No.:L037654)is an aromatic amine featuring an ethoxy group at the 4-position and a fluorine atom at the 2-position of the benzene ring. This compound is commonly used in pharmaceutical research and organic synthesis as an intermediate in the development of biologically active molecules, including potential drug candidates. Its structure offers unique reactivity, making it valuable for various chemical transformations, such as nucleophilic substitutions and coupling reactions. Researchers in medicinal chemistry and materials science utilize this compound to create innovative therapies and advanced materials.
CAS Number | 470702-37-5 |
Molecular Formula | C8H10FNO |
Purity | ≥95% |
IUPAC Name | 4-ethoxy-2-fluoroaniline |
InChI | InChI=1S/C8H10FNO/c1-2-11-6-3-4-8(10)7(9)5-6/h3-5H,2,10H2,1H3 |
InChIKey | HDPGMJKNRMBTHT-UHFFFAOYSA-N |
SMILES | CCOC1=CC(=C(C=C1)N)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |