For research use only. Not for therapeutic Use.
(4-Ethenylphenyl)trimethoxy-Silane (Cat.No:M078917) is a silane compound used as a versatile coupling agent in organic synthesis and surface modification processes. With a phenyl group and ethenyl functionality attached to a silicon atom, it facilitates adhesion between organic and inorganic materials, making it valuable in coating, adhesive, and composite applications.
| CAS Number | 18001-13-3 |
| Molecular Formula | C11H16O3Si |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (4-ethenylphenyl)-trimethoxysilane |
| InChI | InChI=1S/C11H16O3Si/c1-5-10-6-8-11(9-7-10)15(12-2,13-3)14-4/h5-9H,1H2,2-4H3 |
| InChIKey | LTQBNYCMVZQRSD-UHFFFAOYSA-N |
| SMILES | CO[Si](C1=CC=C(C=C1)C=C)(OC)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
