For research use only. Not for therapeutic Use.
4-(Dimethylamino)benzamide(CAT: L040307) is an organic compound with a dimethylamino group attached to the benzene ring at the 4-position and an amide group at the para position. This structure provides both electron-donating (dimethylamino) and electron-withdrawing (amide) functional groups, making it a valuable intermediate in organic synthesis and medicinal chemistry. 4-(Dimethylamino)benzamide is often used as a building block in the development of dyes, polymers, and biologically active molecules. In pharmaceutical research, it can serve as a precursor in synthesizing compounds that target specific receptors or enzymes, particularly those relevant in cancer and neurological research. Its dual functional groups enhance its versatility in chemical modifications and drug development.
CAS Number | 6083-47-2 |
Molecular Formula | C9H12N2O |
Purity | ≥95% |
IUPAC Name | 4-(dimethylamino)benzamide |
InChI | InChI=1S/C9H12N2O/c1-11(2)8-5-3-7(4-6-8)9(10)12/h3-6H,1-2H3,(H2,10,12) |
InChIKey | NWIDZTRKSULSGB-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |