For research use only. Not for therapeutic Use.
4-(Dimethoxymethyl)benzoic acid(Cat No.:L013220)is an aromatic carboxylic acid with a dimethoxymethyl group attached to the 4-position of the benzene ring. This compound is used in pharmaceutical and chemical research as a versatile intermediate for synthesizing more complex molecules, including bioactive compounds and potential drug candidates. The presence of the dimethoxymethyl group allows for selective chemical transformations, making it valuable in the development of advanced materials and fine chemicals. 4-(Dimethoxymethyl)benzoic acid is essential for researchers focused on innovative synthetic chemistry and medicinal applications.
| CAS Number | 120465-56-7 |
| Molecular Formula | C10H12O4 |
| Purity | ≥95% |
| IUPAC Name | 4-(dimethoxymethyl)benzoic acid |
| InChI | InChI=1S/C10H12O4/c1-13-10(14-2)8-5-3-7(4-6-8)9(11)12/h3-6,10H,1-2H3,(H,11,12) |
| InChIKey | ONEJCELGMOSPNT-UHFFFAOYSA-N |
| SMILES | COC(C1=CC=C(C=C1)C(=O)O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |