For research use only. Not for therapeutic Use.
4-(Dimethoxymethyl)-2-(methylsulfonyl)pyrimidine(Cat No.:L028569)is a high-purity heterocyclic compound widely used in pharmaceutical and chemical research. This molecule features a pyrimidine core with a dimethoxymethyl group at the 4-position and a methylsulfonyl group at the 2-position, making it a versatile intermediate in the synthesis of bioactive compounds, including potential drug candidates. Its unique structure facilitates specific reactivity in various chemical transformations. 4-(Dimethoxymethyl)-2-(methylsulfonyl)pyrimidine is ideal for precise synthetic applications, contributing to advancements in medicinal chemistry and innovative research.
CAS Number | 874279-26-2 |
Molecular Formula | C8H12N2O4S |
Purity | ≥95% |
IUPAC Name | 4-(dimethoxymethyl)-2-methylsulfonylpyrimidine |
InChI | InChI=1S/C8H12N2O4S/c1-13-7(14-2)6-4-5-9-8(10-6)15(3,11)12/h4-5,7H,1-3H3 |
InChIKey | MEDAIGDHJAKXIN-UHFFFAOYSA-N |
SMILES | COC(C1=NC(=NC=C1)S(=O)(=O)C)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |