For research use only. Not for therapeutic Use.
4-(Difluoromethoxy)iodobenzene(CAT: M113440) is a highly functionalized aromatic compound widely used in pharmaceutical, chemical, and material science research. Its unique structure, featuring an iodobenzene core substituted with a difluoromethoxy group, makes it a valuable building block for organic synthesis. This compound is particularly useful in cross-coupling reactions, facilitating the creation of complex molecules for drug discovery, agrochemical development, and advanced material design. With high purity and stability, 4-(Difluoromethoxy)iodobenzene enables precise and efficient synthetic pathways, supporting innovative research in medicinal chemistry and synthetic methodologies.
| CAS Number | 128140-82-9 |
| Molecular Formula | C7H5F2IO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-(difluoromethoxy)-4-iodobenzene |
| InChI | InChI=1S/C7H5F2IO/c8-7(9)11-6-3-1-5(10)2-4-6/h1-4,7H |
| InChIKey | KBNPQVHJUYEJIZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC(F)F)I |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |