For research use only. Not for therapeutic Use.
4-Di-2-ASP(Cat No.:R071746)is a lipophilic fluorescent dye widely used in membrane potential studies, neuronal imaging, and cellular tracking. As a cationic amphiphilic probe, it selectively incorporates into biological membranes, making it ideal for real-time visualization of membrane dynamics, synaptic activity, and intracellular transport. This dye is particularly useful in neuroscience, electrophysiology, and live-cell imaging, where it helps study axonal transport, mitochondrial function, and neuronal connectivity. Its strong fluorescence properties make it valuable for tracking cellular processes and understanding membrane-associated mechanisms in biomedical and biochemical research.
| CAS Number | 105802-46-8 |
| Synonyms | N,N-diethyl-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline;iodide |
| Molecular Formula | C18H23IN2 |
| Purity | ≥95% |
| IUPAC Name | N,N-diethyl-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline;iodide |
| InChI | InChI=1S/C18H23N2.HI/c1-4-20(5-2)18-10-8-16(9-11-18)6-7-17-12-14-19(3)15-13-17;/h6-15H,4-5H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | WIPKWLIHFGTFQV-UHFFFAOYSA-M |
| SMILES | CCN(CC)C1=CC=C(C=C1)/C=C/C2=CC=[N+](C=C2)C.[I-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |