4-Cyclopropyloxybenzoic acid is an organic compound featuring a benzoic acid core with a cyclopropyloxy group attached to the 4-position. The presence of the cyclopropyloxy group adds unique chemical properties, making it a versatile intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The benzoic acid moiety provides a reactive carboxyl group, allowing for further derivatization or conjugation in chemical reactions. Researchers utilize 4-Cyclopropyloxybenzoic acid to explore its potential in creating novel bioactive compounds, contributing to drug discovery and other chemical research applications due to its structural diversity and reactivity.
Catalog Number | R063714 |
CAS Number | 62577-90-6 |
Synonyms | 4-(Cyclopropyloxy)-benzoic Acid |
Molecular Formula | C10H10O3 |
Purity | ≥95% |
Storage | 3 years -20C powder |
IUPAC Name | 4-cyclopropyloxybenzoic acid |
InChI | InChI=1S/C10H10O3/c11-10(12)7-1-3-8(4-2-7)13-9-5-6-9/h1-4,9H,5-6H2,(H,11,12) |
InChIKey | VUANULXCHKBPDD-UHFFFAOYSA-N |
SMILES | C1CC1OC2=CC=C(C=C2)C(=O)O |