For research use only. Not for therapeutic Use.
4-Cyclopropyl-2,4-dioxo-butyric acid methyl ester is a specialized ester compound used in organic synthesis and pharmaceutical research. Its cyclopropyl group and dioxo-butyric acid core provide unique reactivity, making it valuable for the synthesis of bioactive molecules and drug intermediates. This compound is often used in the development of enzyme inhibitors and other therapeutic agents. Its ability to undergo various chemical transformations enhances its role in medicinal chemistry, supporting the creation of novel compounds for research and drug discovery.
CAS Number | 167408-67-5 |
Molecular Formula | C8H10O4 |
Purity | ≥95% |
Storage | Store at -20 ℃ |
IUPAC Name | methyl 4-cyclopropyl-2,4-dioxobutanoate |
InChI | InChI=1S/C8H10O4/c1-12-8(11)7(10)4-6(9)5-2-3-5/h5H,2-4H2,1H3 |
InChIKey | MFRDTCKJOFHQDZ-UHFFFAOYSA-N |
SMILES | COC(=O)C(=O)CC(=O)C1CC1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |