For research use only. Not for therapeutic Use.
4-Cyanophenol 2,3,5,6-d4 is a deuterated form of 4-Cyanophenol, where the hydrogen atoms at positions 2, 3, 5, and 6 are replaced with deuterium. This compound is essential for research in organic chemistry and materials science, particularly in studies involving reaction mechanisms, isotopic labeling, and the synthesis of labeled intermediates. The deuterium labeling allows for precise tracking in NMR spectroscopy and mass spectrometry, making 4-Cyanophenol 2,3,5,6-d4 a valuable tool for investigating the behavior of cyanophenol derivatives in various chemical reactions. It is ideal for researchers focused on developing novel synthetic methodologies and exploring the properties of aromatic compounds in complex chemical processes.
| CAS Number | 1025089-21-7 |
| Synonyms | 4-Hydroxybenzonitrile-d4; 4-Hydroxycyanobenzene-d4; NSC 400524-d4; p-Cyanophenol-d4; p-Hydroxybenzonitrile-d4 |
| Molecular Formula | C7H5NO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,3,5,6-tetradeuterio-4-hydroxybenzonitrile |
| InChI | InChI=1S/C7H5NO/c8-5-6-1-3-7(9)4-2-6/h1-4,9H/i1D,2D,3D,4D |
| InChIKey | CVNOWLNNPYYEOH-RHQRLBAQSA-N |
| SMILES | C1=CC(=CC=C1C#N)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |