For research use only. Not for therapeutic Use.
4-(Chloromethyl)-2-methylthiazole(Cat No.:L031183)is a thiazole derivative notable for its chloromethyl and methyl groups, enhancing its chemical versatility and reactivity. This compound serves as a valuable intermediate in synthesizing various pharmaceuticals, agrochemicals, and aromatic compounds. Its structure allows it to undergo nucleophilic substitution reactions, facilitating the introduction of additional functional groups. This capability is particularly useful in creating compounds with antimicrobial and antifungal properties. Additionally, 4-(Chloromethyl)-2-methylthiazole is used in the development of corrosion inhibitors and as a building block in organic synthesis, showcasing its broad utility in chemical research.
CAS Number | 39238-07-8 |
Molecular Formula | C5H6ClNS |
Purity | ≥95% |
IUPAC Name | 4-(chloromethyl)-2-methyl-1,3-thiazole |
InChI | InChI=1S/C5H6ClNS/c1-4-7-5(2-6)3-8-4/h3H,2H2,1H3 |
InChIKey | AQBBZYVPKBIILN-UHFFFAOYSA-N |
SMILES | CC1=NC(=CS1)CCl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |