For research use only. Not for therapeutic Use.
4-(Chloromethyl)-2-methoxy-6-methylpyridine(CAT: L011289) is a high-purity heterocyclic compound featuring a chloromethyl group, a methoxy group, and a methyl-substituted pyridine ring. This versatile molecule serves as an essential intermediate in pharmaceutical and chemical research, particularly in the synthesis of bioactive compounds and complex organic frameworks. Its unique structure and reactivity make it valuable for medicinal chemistry applications, facilitating the development of novel therapeutic agents. With consistent quality and exceptional stability, 4-(Chloromethyl)-2-methoxy-6-methylpyridine supports innovative research in drug discovery, organic synthesis, and advanced material science.
CAS Number | 1227595-34-7 |
Molecular Formula | C8H10ClNO |
Purity | ≥95% |
IUPAC Name | 4-(chloromethyl)-2-methoxy-6-methylpyridine |
InChI | InChI=1S/C8H10ClNO/c1-6-3-7(5-9)4-8(10-6)11-2/h3-4H,5H2,1-2H3 |
InChIKey | WKFBNBJLPZFJKL-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC(=N1)OC)CCl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |