4-Chlorobenzaldehyde (Cat. No: R022752) is insoluble in water, soluble in ethanol, ether, benzene, soluble water, and acetone. Can volatilize with water vapor. It is used as a pharmaceutical and dye intermediate for the manufacture of fenalatrol, aminophenyl butyric acid, etc.
| Catalog Number | R022752 |
| CAS Number | 104-88-1 |
| Synonyms | 4-Formylphenyl Chloride; NSC 2078; p-Chlorobenzaldehyde; p-Chlorobenzenecarboxaldehyde; p-Chlorophenylaldehyde; para-Chlorobenzaldehyde; |
| Molecular Formula | C7H5ClO |
| Purity | 95% |
| Storage | Store at RT |
| IUPAC Name | 4-chlorobenzaldehyde |
| InChI | InChI=1S/C7H5ClO/c8-7-3-1-6(5-9)2-4-7/h1-5H |
| InChIKey | AVPYQKSLYISFPO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)Cl |
