For research use only. Not for therapeutic Use.
4-Chloro-7-azaindole (Cat No.: R007969) is a halogenated heterocyclic compound featuring a fused indole and pyridine ring system, with a chlorine atom at the 4-position and a nitrogen atom at the 7-position. This structure provides unique electronic and hydrogen-bonding properties, making it a valuable scaffold in medicinal chemistry. It is commonly used in the development of kinase inhibitors and other therapeutics targeting protein-ligand interactions. The chlorine atom allows for further functionalization via cross-coupling reactions, enabling structure–activity relationship (SAR) studies in drug discovery.
| CAS Number | 55052-28-3 |
| Synonyms | 4-Chloro-1H-pyrrolo[2,3-b]pyridine; |
| Molecular Formula | C7H5ClN2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-chloro-1H-pyrrolo[2,3-b]pyridine |
| InChI | InChI=1S/C7H5ClN2/c8-6-2-4-10-7-5(6)1-3-9-7/h1-4H,(H,9,10) |
| InChIKey | HNTZVGMWXCFCTA-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC=CC(=C21)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
