For research use only. Not for therapeutic Use.
4-Chloro-5-fluoro-o-phenylenediamine(Cat No.:M109377)is a chemical compound characterized by the presence of both chlorine and fluorine substituents on a benzene ring, which is further functionalized with two amino groups. Its molecular formula is C6H5ClFN2. This compound is primarily used as an intermediate in the synthesis of dyes, pigments, and pharmaceuticals, offering versatile applications due to its reactive amino groups and halogenated aromatic ring. Its unique structure allows it to participate in various organic synthesis reactions, making it valuable for creating complex molecules in material science and drug development.
| CAS Number | 139512-70-2 |
| Molecular Formula | C6H6ClFN2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-chloro-5-fluorobenzene-1,2-diamine |
| InChI | InChI=1S/C6H6ClFN2/c7-3-1-5(9)6(10)2-4(3)8/h1-2H,9-10H2 |
| InChIKey | BSMPRJISGCTCDC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Cl)N)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |