For research use only. Not for therapeutic Use.
4-Chloro-5-fluoro-2-methoxyaniline(Cat No.:L007524), is a chemical compound with a molecular structure comprising an aniline ring substituted with chlorine, fluorine, and a methoxy group. This compound is significant in the field of organic synthesis and medicinal chemistry. Its unique structure and reactivity make it valuable for the development of various organic compounds, including pharmaceuticals and agrochemicals.
CAS Number | 1268392-91-1 |
Molecular Formula | C7H7ClFNO |
Purity | ≥95% |
IUPAC Name | 4-chloro-5-fluoro-2-methoxyaniline |
InChI | InChI=1S/C7H7ClFNO/c1-11-7-2-4(8)5(9)3-6(7)10/h2-3H,10H2,1H3 |
InChIKey | QULHJMQJXYTTTA-UHFFFAOYSA-N |
SMILES | COC1=CC(=C(C=C1N)F)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |