For research use only. Not for therapeutic Use.
(4-Chloro-3-methyl phenyl)methanesulfonyl chloride(Cat No.:L007858), with the chemical formula C8H8Cl2O2S. It is a sulfonyl chloride derivative containing a chloromethylsulfonyl group attached to a 4-chloro-3-methylphenyl ring. Sulfonyl chlorides are versatile reagents in organic synthesis, frequently used for introducing sulfonyl groups into various compounds. Compounds like this are crucial in medicinal and agrochemical research, serving as intermediates for the development of pharmaceuticals, dyes, and functional materials. The chloro substituents enhance its reactivity, making it valuable for a wide range of chemical transformations, enabling the creation of complex organic molecules for diverse applications.
CAS Number | 1522115-36-1 |
Molecular Formula | C8H8Cl2O2S |
Purity | ≥95% |
IUPAC Name | (4-chloro-3-methylphenyl)methanesulfonyl chloride |
InChI | InChI=1S/C8H8Cl2O2S/c1-6-4-7(2-3-8(6)9)5-13(10,11)12/h2-4H,5H2,1H3 |
InChIKey | OIWQZLQYWYCVCP-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC(=C1)CS(=O)(=O)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |