For research use only. Not for therapeutic Use.
4-Chloro-2-methylbenzhydrazide(Cat No.:L027330)is a chemical compound that features a benzhydrazide structure with chlorine and methyl groups on the benzene ring. This configuration imparts distinct chemical reactivity, making it a valuable intermediate in the synthesis of pharmaceuticals, particularly those involving hydrazine derivatives. The presence of the chlorine atom enhances its electrophilic properties, facilitating various organic reactions, while the methyl group increases steric hindrance and lipophilicity, improving the pharmacokinetic profiles of derived drugs. 4-Chloro-2-methylbenzhydrazide is crucial for developing new therapeutic agents with enhanced activity and stability.
| CAS Number | 75319-02-7 |
| Molecular Formula | C8H9ClN2O |
| Purity | ≥95% |
| IUPAC Name | 4-chloro-2-methylbenzohydrazide |
| InChI | InChI=1S/C8H9ClN2O/c1-5-4-6(9)2-3-7(5)8(12)11-10/h2-4H,10H2,1H3,(H,11,12) |
| InChIKey | KJXUWMCNRKHLCR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)C(=O)NN |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |