Home
>
Chemical Reagents>Heterocyclic Building Blocks> 4-Chloro-2-(methoxymethyl)-6-methylpyrimidine
For research use only. Not for therapeutic Use.
4-Chloro-2-(methoxymethyl)-6-methylpyrimidine(Cat No.:L007268), is a key chemical compound widely used in organic synthesis and medicinal chemistry. This crystalline solid consists of a pyrimidine ring substituted with chlorine, a methoxymethyl group, and a methyl group. Researchers employ this compound as a versatile building block for the synthesis of various pharmaceuticals, agrochemicals, and functional materials. Its strategic placement of functional groups makes it valuable in the creation of diverse complex molecules. Its applications span drug discovery, crop protection, and materials science, emphasizing its significance in the development of innovative compounds with potential biological and industrial applications.
| CAS Number | 3122-80-3 |
| Molecular Formula | C7H9ClN2O |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | 4-chloro-2-(methoxymethyl)-6-methylpyrimidine |
| InChI | InChI=1S/C7H9ClN2O/c1-5-3-6(8)10-7(9-5)4-11-2/h3H,4H2,1-2H3 |
| InChIKey | LRAIBXGPDUQUBD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)COC)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |