For research use only. Not for therapeutic Use.
4-Chloro-2-methoxy-6-nitroaniline is an aromatic amine characterized by a chloro substituent at the 4-position, a methoxy group at the 2-position, and a nitro group at the 6-position on the benzene ring. This compound features a rich reactivity profile, making it valuable in organic synthesis and medicinal chemistry. Its diverse functional groups suggest potential applications in developing pharmaceuticals, agrochemicals, and dyes. Additionally, the specific arrangement of substituents can influence its biological activity and reactivity in various chemical processes.
CAS Number | 859877-49-9 |
Molecular Formula | C7H7ClN2O3 |
Purity | ≥95% |
IUPAC Name | 4-chloro-2-methoxy-6-nitroaniline |
InChI | InChI=1S/C7H7ClN2O3/c1-13-6-3-4(8)2-5(7(6)9)10(11)12/h2-3H,9H2,1H3 |
InChIKey | MQNYHIKKJRBLTG-UHFFFAOYSA-N |
SMILES | COC1=CC(=CC(=C1N)[N+](=O)[O-])Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |