For research use only. Not for therapeutic Use.
4-Chloro-2-ethyl-1-fluorobenzene(CAT: L048921) is a high-purity compound widely utilized in pharmaceutical and chemical research. This halogenated aromatic derivative features a unique combination of chloro, ethyl, and fluoro substituents, making it a valuable intermediate in the synthesis of complex organic molecules. Its structural properties enable precise incorporation into diverse chemical pathways, enhancing the efficiency of target molecule development. Ideal for medicinal chemistry, material science, and agrochemical research, 4-Chloro-2-ethyl-1-fluorobenzene ensures consistent performance and reliable results. With its exceptional stability and reactivity, this compound supports innovative applications in advanced research and industrial processes, meeting the rigorous demands of scientific investigation.
| CAS Number | 1369889-05-3 |
| Molecular Formula | C8H8ClF |
| Purity | ≥95% |
| IUPAC Name | 4-chloro-2-ethyl-1-fluorobenzene |
| InChI | InChI=1S/C8H8ClF/c1-2-6-5-7(9)3-4-8(6)10/h3-5H,2H2,1H3 |
| InChIKey | KJQIWHNCILXLMV-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC(=C1)Cl)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |