For research use only. Not for therapeutic Use.
4-Chloro-1-methyl-1H-indole(Cat No.:L031184)is a high-purity heterocyclic compound widely used in pharmaceutical and chemical research. This molecule features an indole core with a chlorine atom at the 4-position and a methyl group at the nitrogen atom, making it a valuable intermediate in the synthesis of bioactive compounds, including potential drug candidates. Its unique structure allows for selective reactivity in various chemical transformations. 4-Chloro-1-methyl-1H-indole is essential for precise synthetic applications, contributing to advancements in medicinal chemistry and the development of novel therapeutic agents.
CAS Number | 77801-91-3 |
Molecular Formula | C9H8ClN |
Purity | ≥95% |
IUPAC Name | 4-chloro-1-methylindole |
InChI | InChI=1S/C9H8ClN/c1-11-6-5-7-8(10)3-2-4-9(7)11/h2-6H,1H3 |
InChIKey | WUFPOENCCOPNCC-UHFFFAOYSA-N |
SMILES | CN1C=CC2=C1C=CC=C2Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |