For research use only. Not for therapeutic Use.
4-Bromoquinoline-8-carbonitrile(Cat No.:L006701), is a chemical compound featuring a quinoline ring substituted with a bromine atom at the 4th position and a cyano group at the 8th position. This compound is essential in organic synthesis, serving as a key intermediate for the preparation of various complex molecules, especially in medicinal chemistry and agrochemical research. Its specific structure and reactivity make it valuable for the development of pharmaceuticals and functional materials.
| CAS Number | 1020743-28-5 |
| Molecular Formula | C10H5BrN2 |
| Purity | ≥95% |
| IUPAC Name | 4-bromoquinoline-8-carbonitrile |
| InChI | InChI=1S/C10H5BrN2/c11-9-4-5-13-10-7(6-12)2-1-3-8(9)10/h1-5H |
| InChIKey | MQKWVLSWSZHDGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)C(=CC=N2)Br)C#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |