4-Bromophenylacetic Acid - CAS 1878-68-8

4-Bromophenylacetic Acid (CAT: R005874) is a chemical compound belonging to the class of phenylacetic acids. It consists of a phenyl ring with a bromine atom substituted at the fourth position and a carboxylic acid group attached to the phenyl ring. This compound has potential applications in organic synthesis as an intermediate for the preparation of various pharmaceuticals and agrochemicals. It serves as a building block in the synthesis of more complex molecules due to its ability to undergo various chemical reactions, including esterification, amidation, and coupling reactions.

Catalog Number: R005874

CAS Number: 1878-68-8

PubChem Substance ID:355121323

Molecular Formula: C8H7BrO2

Molecular Weight:215.046

Purity: ≥95%

* For research use only. Not for human or veterinary use.

Synonym

Synonyms4-Bromobenzeneacetic Acid; (p-Bromophenyl)acetic acid; 2-(4-Bromophenyl)acetic acid; NSC 14358;

Property

Molecular Formula: C8H7BrO2
Molecular Weight215.046
Purity≥95%
StorageDesiccate at +4C

Computed Descriptor

IUPAC Name2-(4-bromophenyl)acetic acid
InChIInChI=1S/C8H7BrO2/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4H,5H2,(H,10,11)
InChIKeyQOWSWEBLNVACCL-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CC(=O)O)Br