4-Bromophenylacetic Acid (CAT: R005874) is a chemical compound belonging to the class of phenylacetic acids. It consists of a phenyl ring with a bromine atom substituted at the fourth position and a carboxylic acid group attached to the phenyl ring. This compound has potential applications in organic synthesis as an intermediate for the preparation of various pharmaceuticals and agrochemicals. It serves as a building block in the synthesis of more complex molecules due to its ability to undergo various chemical reactions, including esterification, amidation, and coupling reactions.
| Catalog Number | R005874 |
| CAS Number | 1878-68-8 |
| Synonyms | 4-Bromobenzeneacetic Acid; (p-Bromophenyl)acetic acid; 2-(4-Bromophenyl)acetic acid; NSC 14358; |
| Molecular Formula | C8H7BrO2 |
| Purity | 95% |
| Storage | Desiccate at +4C |
| IUPAC Name | 2-(4-bromophenyl)acetic acid |
| InChI | InChI=1S/C8H7BrO2/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | QOWSWEBLNVACCL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)Br |
