For research use only. Not for therapeutic Use.
4-Bromophenol-2,3,5,6-d4 is a deuterated form of 4-bromophenol, where four hydrogen atoms on the phenol ring are replaced with deuterium. This isotopic labeling makes the compound particularly useful in analytical and environmental studies, especially in NMR spectroscopy and mass spectrometry, allowing for precise tracking and analysis. The deuterium atoms help differentiate this compound in complex mixtures or in studies of its chemical reactions and behavior in various systems. Despite the isotopic substitution, 4-Bromophenol-2,3,5,6-d4 retains the same chemical reactivity and properties as its non-deuterated counterpart, making it valuable for research and industrial applications.
CAS Number | 152404-44-9 |
Molecular Formula | C6H5BrO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-bromo-2,3,5,6-tetradeuteriophenol |
InChI | InChI=1S/C6H5BrO/c7-5-1-3-6(8)4-2-5/h1-4,8H/i1D,2D,3D,4D |
InChIKey | GZFGOTFRPZRKDS-RHQRLBAQSA-N |
SMILES | C1=CC(=CC=C1O)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |