For research use only. Not for therapeutic Use.
4-(Bromomethyl)-2,2-dimethyl-1,3-dioxolane is a high-purity compound used in organic synthesis and medicinal chemistry. This brominated dioxolane derivative is essential for studying alkylation reactions and as an intermediate in the synthesis of complex molecules. Its precise composition ensures reliable and reproducible results, making it indispensable for advanced chemical synthesis and drug development applications. Ideal for experimental setups, 4-(Bromomethyl)-2,2-dimethyl-1,3-dioxolane enhances research accuracy and efficiency.
| CAS Number | 36236-76-7 |
| Molecular Formula | C6H11BrO2 |
| Purity | ≥95% |
| IUPAC Name | 4-(bromomethyl)-2,2-dimethyl-1,3-dioxolane |
| InChI | InChI=1S/C6H11BrO2/c1-6(2)8-4-5(3-7)9-6/h5H,3-4H2,1-2H3 |
| InChIKey | ZOPZKFNSQYCIPP-UHFFFAOYSA-N |
| SMILES | CC1(OCC(O1)CBr)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |