For research use only. Not for therapeutic Use.
4-Bromomethyl-2-(4-chlorophenyl)thiazole(CAT: L000011) is a significant compound with applications in organic chemistry. This chemical serves as a key intermediate in the synthesis of various organic compounds, allowing for the diversification of chemical synthesis. Its unique structure provides a valuable building block for the creation of specialized molecules with potential uses in various applications within the field of organic chemistry.
CAS Number | 835346-86-6 |
Molecular Formula | C10H7BrClNS |
Purity | ≥95% |
IUPAC Name | 4-(bromomethyl)-2-(4-chlorophenyl)-1,3-thiazole |
InChI | InChI=1S/C10H7BrClNS/c11-5-9-6-14-10(13-9)7-1-3-8(12)4-2-7/h1-4,6H,5H2 |
InChIKey | AMTMXFWQOUHDAS-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |