For research use only. Not for therapeutic Use.
4-Bromo-7-azaindole (Cat No.: R032231) is a halogenated heterocyclic compound featuring a bromine atom at the 4-position of a 7-azaindole core, a fused pyrrole-pyridine structure. This molecule is widely used in medicinal chemistry as a synthetic intermediate for kinase inhibitors and other biologically active compounds. Its bromine substituent enables selective functionalization via cross-coupling reactions such as Suzuki or Buchwald-Hartwig couplings. The azaindole scaffold contributes to its utility in drug discovery, particularly for targeting ATP-binding sites in protein kinases. For research use only.
| CAS Number | 348640-06-2 |
| Synonyms | 4-Bromo-1H-pyrrolo[2,3-b]pyridine; 4-Bromo-1H-pyrrolo[2,3-b]pyridine |
| Molecular Formula | C7H5BrN2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-bromo-1H-pyrrolo[2,3-b]pyridine |
| InChI | InChI=1S/C7H5BrN2/c8-6-2-4-10-7-5(6)1-3-9-7/h1-4H,(H,9,10) |
| InChIKey | LEZHTYOQWQEBLH-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC=CC(=C21)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |