For research use only. Not for therapeutic Use.
4-Bromo-5-methylisoxazol-3-ol(CAT: L031437) is a high-purity heterocyclic compound widely utilized in chemical and pharmaceutical research. Featuring an isoxazole core with a bromine atom at the 4-position, a methyl group at the 5-position, and a hydroxyl group at the 3-position, this compound serves as a versatile intermediate for synthesizing bioactive molecules and complex organic compounds. Its unique structure and reactivity make it valuable for medicinal chemistry applications, including the development of drug candidates and enzyme inhibitors. 4-Bromo-5-methylisoxazol-3-ol ensures reliable performance, supporting innovative research in drug discovery and advanced organic synthesis.
CAS Number | 10067-92-2 |
Molecular Formula | C4H4BrNO2 |
Purity | ≥95% |
IUPAC Name | 4-bromo-5-methyl-1,2-oxazol-3-one |
InChI | InChI=1S/C4H4BrNO2/c1-2-3(5)4(7)6-8-2/h1H3,(H,6,7) |
InChIKey | GQXJRXHATDGRSM-UHFFFAOYSA-N |
SMILES | CC1=C(C(=O)NO1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |