For research use only. Not for therapeutic Use.
4-Bromo-5-fluoro-2,3-dihydro-1H-inden-1-one is a halogenated indenone derivative featuring a bromine atom at the 4-position and a fluorine atom at the 5-position. This compound is of interest in organic synthesis and medicinal chemistry due to its unique bicyclic structure, which can be further functionalized to create diverse chemical entities. Its halogen substituents enhance reactivity, making it suitable for cross-coupling reactions. It may also exhibit potential biological activities, contributing to the development of new pharmaceuticals and agrochemicals.
| CAS Number | 935681-01-9 |
| Molecular Formula | C9H6BrFO |
| Purity | ≥95% |
| IUPAC Name | 4-bromo-5-fluoro-2,3-dihydroinden-1-one |
| InChI | InChI=1S/C9H6BrFO/c10-9-6-2-4-8(12)5(6)1-3-7(9)11/h1,3H,2,4H2 |
| InChIKey | JTVKCVNXTBXSOL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=C(C=C2)F)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |