For research use only. Not for therapeutic Use.
4-Bromo-5-chloro-2-fluorobenzaldehyde(Cat No.:L023792)is a high-purity aromatic aldehyde essential for advanced pharmaceutical and chemical research. This halogenated compound, featuring bromine, chlorine, and fluorine atoms, is widely used in the synthesis of complex organic molecules, particularly in the development of novel drug candidates. Its unique substitution pattern allows for diverse chemical transformations, making it an indispensable building block in medicinal chemistry. With exceptional stability and reactivity, 4-Bromo-5-chloro-2-fluorobenzaldehyde is ideal for precise and reliable synthetic applications in research and development.
CAS Number | 1603584-72-0 |
Molecular Formula | C7H3BrClFO |
Purity | ≥95% |
IUPAC Name | 4-bromo-5-chloro-2-fluorobenzaldehyde |
InChI | InChI=1S/C7H3BrClFO/c8-5-2-7(10)4(3-11)1-6(5)9/h1-3H |
InChIKey | AJGYCHJPYQRCMC-UHFFFAOYSA-N |
SMILES | C1=C(C(=CC(=C1Cl)Br)F)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |