For research use only. Not for therapeutic Use.
4-Bromo-3-methylbenzo[d]isoxazole(CAT: L016611) is a high-purity brominated heterocyclic compound widely utilized in pharmaceutical and chemical research. Its unique benzo[d]isoxazole core, functionalized with a bromine atom and a methyl group, makes it an essential building block in the synthesis of complex organic molecules and active pharmaceutical ingredients. This compound is particularly valuable in medicinal chemistry, aiding the development of novel therapeutic agents. Its well-defined structure and reactivity make it ideal for exploring innovative chemical transformations. 4-Bromo-3-methylbenzo[d]isoxazole ensures consistent quality, supporting advanced research in drug discovery and material science applications.
CAS Number | 1367947-42-9 |
Molecular Formula | C8H6BrNO |
Purity | ≥95% |
IUPAC Name | 4-bromo-3-methyl-1,2-benzoxazole |
InChI | InChI=1S/C8H6BrNO/c1-5-8-6(9)3-2-4-7(8)11-10-5/h2-4H,1H3 |
InChIKey | HJTPZDBIOWXAFI-UHFFFAOYSA-N |
SMILES | CC1=NOC2=C1C(=CC=C2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |