For research use only. Not for therapeutic Use.
4-Bromo-2,6-di-tert-butylanisole (Cat No.: M048457) is a bulky aromatic compound featuring a bromine atom at the 4-position, tert-butyl groups at the 2 and 6 positions, and a methoxy group at the 1-position of a benzene ring. Its steric hindrance and electron-donating methoxy group make it valuable in organic synthesis, particularly in cross-coupling reactions such as Suzuki or Buchwald–Hartwig amination. It serves as an intermediate in the preparation of ligands, catalysts, and functional materials, especially where steric protection or electronic tuning is required.
| CAS Number | 1516-96-7 |
| Molecular Formula | C15H23BrO |
| Purity | ≥95% |
| Storage | Desiccate at +4℃ |
| IUPAC Name | 5-bromo-1,3-ditert-butyl-2-methoxybenzene |
| InChI | InChI=1S/C15H23BrO/c1-14(2,3)11-8-10(16)9-12(13(11)17-7)15(4,5)6/h8-9H,1-7H3 |
| InChIKey | KKHJQLVAMOKQHO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1OC)C(C)(C)C)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |