For research use only. Not for therapeutic Use.
4-Bromo-2,5-difluorobenzonitrile (Cat No.: M135924) is a halogenated aromatic compound featuring a nitrile group at the 1-position, fluorine atoms at the 2 and 5 positions, and a bromine atom at the 4-position on the benzene ring. It serves as a versatile intermediate in organic synthesis, particularly in the development of pharmaceuticals, agrochemicals, and functional materials. The electron-withdrawing halogens and nitrile group enhance its reactivity in cross-coupling reactions, such as Suzuki or Buchwald–Hartwig, enabling the construction of complex aromatic compounds.
| CAS Number | 133541-45-4 |
| Molecular Formula | C7H2BrF2N |
| Purity | ≥95% |
| Storage | Store at +4℃ |
| IUPAC Name | 4-bromo-2,5-difluorobenzonitrile |
| InChI | InChI=1S/C7H2BrF2N/c8-5-2-6(9)4(3-11)1-7(5)10/h1-2H |
| InChIKey | YIEQHIRFLYNDKP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)F)C#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |