For research use only. Not for therapeutic Use.
4-Bromo-2-methylphenylboronic acid(CAT: L035459) is a high-purity aromatic boronic acid widely utilized in chemical and pharmaceutical research. Featuring a phenyl ring with a bromine atom at the 4-position, a methyl group at the 2-position, and a boronic acid functional group, this compound serves as a key intermediate in organic synthesis. It is particularly effective in Suzuki-Miyaura cross-coupling reactions for constructing complex molecules, including bioactive compounds and advanced materials. 4-Bromo-2-methylphenylboronic acid ensures consistent performance, supporting innovation in medicinal chemistry, agrochemical development, and material science.
| CAS Number | 221006-71-9 |
| Molecular Formula | C7H8BBrO2 |
| Purity | ≥95% |
| IUPAC Name | (4-bromo-2-methylphenyl)boronic acid |
| InChI | InChI=1S/C7H8BBrO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4,10-11H,1H3 |
| InChIKey | BEQUDVVISBTSHZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Br)C)(O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |