For research use only. Not for therapeutic Use.
4-Bromo-2-(chloromethyl)-1-iodobenzene(CAT: L013098) is a halogenated aromatic compound with both bromine and iodine substituents on a benzene ring, along with a chloromethyl group at the ortho position relative to the iodine. This structure makes it a highly reactive intermediate, commonly used in organic synthesis, particularly in cross-coupling reactions such as Suzuki or Heck reactions. Its halogen groups provide versatile sites for further functionalization, while the chloromethyl group can be used for nucleophilic substitution reactions. This compound is valuable for constructing complex molecules in pharmaceutical research, agrochemicals, or materials science due to its reactivity and potential for multi-step synthesis pathways.
CAS Number | 1261817-10-0 |
Molecular Formula | C7H5BrClI |
Purity | ≥95% |
IUPAC Name | 4-bromo-2-(chloromethyl)-1-iodobenzene |
InChI | InChI=1S/C7H5BrClI/c8-6-1-2-7(10)5(3-6)4-9/h1-3H,4H2 |
InChIKey | OVMPAVCSOVHNOB-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |