For research use only. Not for therapeutic Use.
4-Bromo-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine（Cat No.:L031841）is a halogenated, fluorinated pyridine derivative used as an intermediate in pharmaceutical and agrochemical synthesis. Its structure features a bromine atom at the 4-position and a bulky trifluoromethyl-substituted alkyl group at the 2-position of the pyridine ring, contributing to its steric and electronic properties. The trifluoromethyl group enhances lipophilicity and metabolic stability, making the compound valuable in designing bioactive molecules with improved pharmacokinetics. Its reactivity, especially in cross-coupling reactions, enables incorporation into complex molecular frameworks during medicinal chemistry and materials science research.
| CAS Number | 1357476-67-5 |
| Molecular Formula | C9H9BrF3N |
| Purity | ≥95% |
| IUPAC Name | 4-bromo-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine |
| InChI | InChI=1S/C9H9BrF3N/c1-8(2,9(11,12)13)7-5-6(10)3-4-14-7/h3-5H,1-2H3 |
| InChIKey | XAQNICQGPIHIIH-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=NC=CC(=C1)Br)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
