For research use only. Not for therapeutic Use.
4-Bromo-1H-pyrrolo[2,3-c]pyridine(Cat No.:L042411)is a brominated heterocyclic compound that combines a pyrrole and pyridine ring structure. The presence of a bromine atom at the 4-position enhances its utility as a versatile intermediate in chemical synthesis, especially in the pharmaceutical industry where it is used to develop kinase inhibitors and other biologically active molecules. Its structure allows for nucleophilic substitution reactions, which are crucial for functionalizing the molecule further. 4-Bromo-1H-pyrrolo[2,3-c]pyridine is instrumental in the synthesis of complex compounds aimed at treating a variety of diseases, including cancers and inflammatory disorders.
CAS Number | 69872-17-9 |
Molecular Formula | C7H5BrN2 |
Purity | ≥95% |
IUPAC Name | 4-bromo-1H-pyrrolo[2,3-c]pyridine |
InChI | InChI=1S/C7H5BrN2/c8-6-3-9-4-7-5(6)1-2-10-7/h1-4,10H |
InChIKey | NZUWATDXQMWXMY-UHFFFAOYSA-N |
SMILES | C1=CNC2=CN=CC(=C21)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |