For research use only. Not for therapeutic Use.
4-Bromo-1-(tert-butyldimethylsilyl)indole(Cat No.:M038488)is a high-purity compound commonly used in pharmaceutical research and organic synthesis. This brominated indole derivative, featuring a tert-butyldimethylsilyl (TBDMS) protecting group, is essential for selective modifications during the synthesis of complex molecules. Its structure makes it valuable in medicinal chemistry, particularly for developing bioactive compounds and novel therapeutic agents. 4-Bromo-1-(tert-butyldimethylsilyl)indole is crucial for research focused on optimizing synthetic pathways, offering reliable performance in advanced chemical synthesis and facilitating the exploration of innovative drug candidates.
| CAS Number | 193694-04-1 |
| Molecular Formula | C14H20BrNSi |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | (4-bromoindol-1-yl)-tert-butyl-dimethylsilane |
| InChI | InChI=1S/C14H20BrNSi/c1-14(2,3)17(4,5)16-10-9-11-12(15)7-6-8-13(11)16/h6-10H,1-5H3 |
| InChIKey | LTHHTJMKYUPWCR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)N1C=CC2=C1C=CC=C2Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |