For research use only. Not for therapeutic Use.
4-Bromo-1-methylindolin-2-one(Cat No.:L043035)is a versatile brominated indolinone derivative extensively used in organic synthesis and pharmaceutical research. It acts as a valuable building block for designing and synthesizing various heterocyclic compounds, including kinase inhibitors and other bioactive molecules. Its bromo group offers unique reactivity, facilitating cross-coupling reactions that are essential in constructing complex molecular architectures. This compound is critical for medicinal chemists aiming to develop novel therapeutic agents with potential applications in treating diverse diseases, making it an indispensable component in advanced drug discovery and development efforts.
CAS Number | 884855-68-9 |
Molecular Formula | C9H8BrNO |
Purity | ≥95% |
IUPAC Name | 4-bromo-1-methyl-3H-indol-2-one |
InChI | InChI=1S/C9H8BrNO/c1-11-8-4-2-3-7(10)6(8)5-9(11)12/h2-4H,5H2,1H3 |
InChIKey | YYTXVBYHPIORNO-UHFFFAOYSA-N |
SMILES | CN1C(=O)CC2=C1C=CC=C2Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |