Home
>
Reference Standards>Organic Building Blocks>Buliding Block Chemicals> 4-Bromo-α-phenylbenzenemethanol
For research use only. Not for therapeutic Use.
4-Bromo-α-phenylbenzenemethanol(CAT: R018316) is an aryl-substituted benzylic alcohol featuring a bromine atom at the para-position, offering both electrophilic reactivity and structural versatility. It serves as a valuable intermediate in the synthesis of pharmaceuticals, fine chemicals, and specialty materials. The compound’s benzylic alcohol functionality allows for straightforward derivatization into esters, ethers, or other reactive species, while the bromine enables cross-coupling reactions such as Suzuki or Heck reactions. Its rigid aromatic framework is ideal for constructing complex molecular scaffolds in medicinal chemistry and organic synthesis. This compound is frequently used in SAR studies, ligand design, and functional material development.
| CAS Number | 29334-16-5 |
| Synonyms | 4-Bromobenzhydrol; 4-Bromobenzohydrol; (4-Bromophenyl)phenylmethanol; (±)-(4-Bromophenyl)phenylmethanol; 4-(1-Hydroxybenzyl)bromobenzene; 4-Bromobenzhydrol; NSC 89817; p-Bromobenzhydrol; α-(4-Bromophenyl)benzenemethanol |
| Molecular Formula | C13H11BrO |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | (4-bromophenyl)-phenylmethanol |
| InChI | InChI=1S/C13H11BrO/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h1-9,13,15H |
| InChIKey | WTIWDBNPPSHSCB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=C(C=C2)Br)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |