For research use only. Not for therapeutic Use.
4-(Benzyloxy)phenyl dodecanoate (Cat.No:L003473) is a crucial compound in organic synthesis. Its structure combines a phenyl ether with a dodecanoate ester, offering diverse reactivity for chemical transformations. This compound finds application in the preparation of specialized materials and as a key intermediate in pharmaceutical research.
| CAS Number | 6638-98-8 |
| Molecular Formula | C25H34O3 |
| Purity | ≥95% |
| IUPAC Name | (4-phenylmethoxyphenyl) dodecanoate |
| InChI | InChI=1S/C25H34O3/c1-2-3-4-5-6-7-8-9-13-16-25(26)28-24-19-17-23(18-20-24)27-21-22-14-11-10-12-15-22/h10-12,14-15,17-20H,2-9,13,16,21H2,1H3 |
| InChIKey | REQBVNBXTOTEPU-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCC(=O)OC1=CC=C(C=C1)OCC2=CC=CC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |