For research use only. Not for therapeutic Use.
4-Benzyloxy-1-ethynyl-3-methoxybenzene (Cat No.: M093685) is an aromatic organic compound featuring a benzene ring substituted with a benzyloxy group at the 4-position, an ethynyl group at the 1-position, and a methoxy group at the 3-position. This pale solid is used as an intermediate in the synthesis of complex molecules for pharmaceuticals, organic materials, and electronic devices. The ethynyl moiety enables further functionalization via cross-coupling reactions, while the benzyloxy and methoxy groups modulate solubility, electronic properties, and steric behavior for targeted applications.
| CAS Number | 144735-54-6 |
| Synonyms | 4-BENZYLOXY-1-ETHYNYL-3-METHOXY-BENZENE |
| Molecular Formula | C16H14O2 |
| Purity | ≥95% |
| Storage | Desiccate at +4℃ |
| IUPAC Name | 4-ethynyl-2-methoxy-1-phenylmethoxybenzene |
| InChI | InChI=1S/C16H14O2/c1-3-13-9-10-15(16(11-13)17-2)18-12-14-7-5-4-6-8-14/h1,4-11H,12H2,2H3 |
| InChIKey | PLUHQGRVJMSIDW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C#C)OCC2=CC=CC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
