For research use only. Not for therapeutic Use.
(4-(Benzo[d]oxazol-2-yl)phenyl)boronic acid (CAT: L000262) is an important compound primarily used in organic and material chemistry. In organic chemistry, it serves as a crucial reagent for the synthesis of various organic molecules, often with specialized functions.
| CAS Number | 1065657-51-3 |
| Molecular Formula | C13H10BNO3 |
| Purity | ≥95% |
| IUPAC Name | [4-(1,3-benzoxazol-2-yl)phenyl]boronic acid |
| InChI | InChI=1S/C13H10BNO3/c16-14(17)10-7-5-9(6-8-10)13-15-11-3-1-2-4-12(11)18-13/h1-8,16-17H |
| InChIKey | PTTJBNMNZAUITF-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |