For research use only. Not for therapeutic Use.
4-Androsten-11β-ol-3,17-dione(Cat No.:R042484) is a synthetic steroidal compound that acts as an intermediate in the biosynthesis of corticosteroids and anabolic steroids. It features a hydroxyl group at the 11β position, which is crucial in steroid metabolism and signaling pathways. This compound is studied for its role in hormone regulation and its potential applications in the development of therapeutics targeting inflammatory conditions, metabolic disorders, and hormone-related diseases. 4-Androsten-11β-ol-3,17-dione is valuable in research exploring adrenal steroidogenesis and the modulation of androgen and glucocorticoid activity, making it essential for advancing endocrinological and pharmaceutical studies.
CAS Number | 382-44-5 |
Synonyms | (11β)-11-Hydroxy-androst-4-ene-3,17-dione; ?11β-Hydroxy-androst-4-ene-3,17-dione; (11β)-11-Hydroxyandrost-4-ene-3,17-dione; 11β-Hydroxy-4-androsten-3,17-dione; 11β-Hydroxy-Δ4-androstene-3,17-dione; 11β-Hydroxyandrost-4-ene-3,17-dione; 4-Androstene-11 |
Molecular Formula | C19H26O3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | (8S,9S,10R,11S,13S,14S)-11-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
InChI | InChI=1S/C19H26O3/c1-18-8-7-12(20)9-11(18)3-4-13-14-5-6-16(22)19(14,2)10-15(21)17(13)18/h9,13-15,17,21H,3-8,10H2,1-2H3/t13-,14-,15-,17+,18-,19-/m0/s1 |
InChIKey | WSCUHXPGYUMQEX-KCZNZURUSA-N |
SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3CCC4=O)C)O O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |