For research use only. Not for therapeutic Use.
4-(Aminomethyl)tetrahydro-2H-pyran-4-carbonitrile（Cat No.:R021699）is a multifunctional heterocyclic compound featuring a tetrahydropyran ring substituted at the 4-position with both an aminomethyl and a nitrile group. This structural arrangement imparts high reactivity and makes it a valuable intermediate in medicinal chemistry and pharmaceutical synthesis. The aminomethyl group offers a handle for further derivatization, while the nitrile moiety serves as a precursor for amides or heterocycles. Its balanced lipophilicity and hydrogen-bonding potential make it suitable for designing CNS-active agents and other bioactive molecules with improved pharmacokinetic properties.
| CAS Number | 1263374-32-8 |
| Synonyms | 4-(Aminomethyl)tetrahydro-2H-pyran-4-carbonitrile |
| Molecular Formula | C₇H₁₂N₂O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-(aminomethyl)oxane-4-carbonitrile |
| InChI | InChI=1S/C7H12N2O/c8-5-7(6-9)1-3-10-4-2-7/h1-5,8H2 |
| InChIKey | WRAFVYHNHMNOCQ-UHFFFAOYSA-N |
| SMILES | C1COCCC1(CN)C#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
