For research use only. Not for therapeutic Use.
4-Aminohippuric acid-d4(Cat No.:S000361) is a deuterated form of 4-aminohippuric acid, where four hydrogen atoms are replaced with deuterium. 4-Aminohippuric acid is used clinically to measure renal plasma flow, helping assess kidney function. The deuterium substitution enhances the chemical stability of the molecule, facilitating more accurate pharmacokinetic and metabolic studies. These studies are crucial for precisely monitoring renal clearance and function, ensuring the effectiveness of the 4-amino hippuric acid test.
| CAS Number | 1219805-41-0 |
| Molecular Formula | C9H6D4N2O3 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| IUPAC Name | 2-[(4-amino-2,3,5,6-tetradeuteriobenzoyl)amino]acetic acid |
| InChI | InChI=1S/C9H10N2O3/c10-7-3-1-6(2-4-7)9(14)11-5-8(12)13/h1-4H,5,10H2,(H,11,14)(H,12,13)/i1D,2D,3D,4D |
| InChIKey | HSMNQINEKMPTIC-RHQRLBAQSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NCC(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |